C17H28O4 — CID 160942813
heptadecane-3,7,11,15-tetrone (PubChem CID 160942813) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is heptadecane-3,7,11,15-tetrone.
| Compound Name | heptadecane-3,7,11,15-tetrone |
|---|---|
| PubChem CID | 160942813 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | heptadecane-3,7,11,15-tetrone |
| SMILES | CCC(=O)CCCC(=O)CCCC(=O)CCCC(=O)CC |
| InChI | InChI=1S/C17H28O4/c1-3-14(18)8-5-10-16(20)12-7-13-17(21)11-6-9-15(19)4-2/h3-13H2,1-2H3 |
| InChIKey | SUSOYGCPLMKCEM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |