About 5-oxoheptanamide
5-oxoheptanamide (PubChem CID 54102648) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is 5-oxoheptanamide.
Molecular Properties
| Compound Name | 5-oxoheptanamide |
| PubChem CID | 54102648 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 5-oxoheptanamide |
| SMILES | CCC(=O)CCCC(N)=O |
| InChI | InChI=1S/C7H13NO2/c1-2-6(9)4-3-5-7(8)10/h2-5H2,1H3,(H2,8,10) |
| InChIKey | RJSZTLGADDVJPF-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-oxoheptanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxoheptanamide?
The IUPAC name of 5-oxoheptanamide (CID 54102648) is 5-oxoheptanamide.
What is the SMILES notation for 5-oxoheptanamide?
The canonical SMILES for 5-oxoheptanamide is CCC(=O)CCCC(N)=O.
What is the InChIKey of 5-oxoheptanamide?
The InChIKey is RJSZTLGADDVJPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2/c1-2-6(9)4-3-5-7(8)10/h2-5H2,1H3,(H2,8,10).
What are the key properties of 5-oxoheptanamide?
5-oxoheptanamide has a molecular weight of 143.19 g/mol, XLogP of 0.62, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxoheptanamide is sourced from PubChem (CID 54102648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).