About 4-methylpentanoyl fluoride;6-oxooctanamide
4-methylpentanoyl fluoride;6-oxooctanamide (PubChem CID 145408347) has the molecular formula C14H26FNO3
and a molecular weight of 275.36 g/mol. Its IUPAC name is 4-methylpentanoyl fluoride;6-oxooctanamide.
Molecular Properties
| Compound Name | 4-methylpentanoyl fluoride;6-oxooctanamide |
| PubChem CID | 145408347 |
| Molecular Formula | C14H26FNO3 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 4-methylpentanoyl fluoride;6-oxooctanamide |
| SMILES | CC(C)CCC(=O)F.CCC(=O)CCCCC(N)=O |
| InChI | InChI=1S/C8H15NO2.C6H11FO/c1-2-7(10)5-3-4-6-8(9)11;1-5(2)3-4-6(7)8/h2-6H2,1H3,(H2,9,11);5H,3-4H2,1-2H3 |
| InChIKey | GDOZJFUXDKSAJF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-methylpentanoyl fluoride;6-oxooctanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpentanoyl fluoride;6-oxooctanamide?
The IUPAC name of 4-methylpentanoyl fluoride;6-oxooctanamide (CID 145408347) is 4-methylpentanoyl fluoride;6-oxooctanamide.
What is the SMILES notation for 4-methylpentanoyl fluoride;6-oxooctanamide?
The canonical SMILES for 4-methylpentanoyl fluoride;6-oxooctanamide is CC(C)CCC(=O)F.CCC(=O)CCCCC(N)=O.
What is the InChIKey of 4-methylpentanoyl fluoride;6-oxooctanamide?
The InChIKey is GDOZJFUXDKSAJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2.C6H11FO/c1-2-7(10)5-3-4-6-8(9)11;1-5(2)3-4-6(7)8/h2-6H2,1H3,(H2,9,11);5H,3-4H2,1-2H3.
What are the key properties of 4-methylpentanoyl fluoride;6-oxooctanamide?
4-methylpentanoyl fluoride;6-oxooctanamide has a molecular weight of 275.36 g/mol, XLogP of 2.93, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpentanoyl fluoride;6-oxooctanamide is sourced from PubChem (CID 145408347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).