About ethane;7-methyloctan-3-one
ethane;7-methyloctan-3-one (PubChem CID 142816942) has the molecular formula C11H24O
and a molecular weight of 172.31 g/mol. Its IUPAC name is ethane;7-methyloctan-3-one.
Molecular Properties
| Compound Name | ethane;7-methyloctan-3-one |
| PubChem CID | 142816942 |
| Molecular Formula | C11H24O |
| Molecular Weight | 172.31 g/mol |
| Exact Mass | 172.18 |
| IUPAC Name | ethane;7-methyloctan-3-one |
| SMILES | CC.CCC(=O)CCCC(C)C |
| InChI | InChI=1S/C9H18O.C2H6/c1-4-9(10)7-5-6-8(2)3;1-2/h8H,4-7H2,1-3H3;1-2H3 |
| InChIKey | KTWKTNNMNRXACA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;7-methyloctan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-methyloctan-3-one?
The IUPAC name of ethane;7-methyloctan-3-one (CID 142816942) is ethane;7-methyloctan-3-one.
What is the SMILES notation for ethane;7-methyloctan-3-one?
The canonical SMILES for ethane;7-methyloctan-3-one is CC.CCC(=O)CCCC(C)C.
What is the InChIKey of ethane;7-methyloctan-3-one?
The InChIKey is KTWKTNNMNRXACA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O.C2H6/c1-4-9(10)7-5-6-8(2)3;1-2/h8H,4-7H2,1-3H3;1-2H3.
What are the key properties of ethane;7-methyloctan-3-one?
ethane;7-methyloctan-3-one has a molecular weight of 172.31 g/mol, XLogP of 3.82, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-methyloctan-3-one is sourced from PubChem (CID 142816942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).