About 9-oxoundecanoic acid
9-oxoundecanoic acid (PubChem CID 5282986) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is 9-oxoundecanoic acid.
Molecular Properties
| Compound Name | 9-oxoundecanoic acid |
| PubChem CID | 5282986 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 9-oxoundecanoic acid |
| SMILES | CCC(=O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C11H20O3/c1-2-10(12)8-6-4-3-5-7-9-11(13)14/h2-9H2,1H3,(H,13,14) |
| InChIKey | KUPZGNQJONLIRP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-oxoundecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-oxoundecanoic acid?
The IUPAC name of 9-oxoundecanoic acid (CID 5282986) is 9-oxoundecanoic acid.
What is the SMILES notation for 9-oxoundecanoic acid?
The canonical SMILES for 9-oxoundecanoic acid is CCC(=O)CCCCCCCC(=O)O.
What is the InChIKey of 9-oxoundecanoic acid?
The InChIKey is KUPZGNQJONLIRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-2-10(12)8-6-4-3-5-7-9-11(13)14/h2-9H2,1H3,(H,13,14).
What are the key properties of 9-oxoundecanoic acid?
9-oxoundecanoic acid has a molecular weight of 200.28 g/mol, XLogP of 2.78, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-oxoundecanoic acid is sourced from PubChem (CID 5282986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).