About methanol;tridecanedioic acid
methanol;tridecanedioic acid (PubChem CID 175511493) has the molecular formula C14H28O5
and a molecular weight of 276.37 g/mol. Its IUPAC name is methanol;tridecanedioic acid.
Molecular Properties
| Compound Name | methanol;tridecanedioic acid |
| PubChem CID | 175511493 |
| Molecular Formula | C14H28O5 |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | methanol;tridecanedioic acid |
| SMILES | CO.O=C(O)CCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C13H24O4.CH4O/c14-12(15)10-8-6-4-2-1-3-5-7-9-11-13(16)17;1-2/h1-11H2,(H,14,15)(H,16,17);2H,1H3 |
| InChIKey | QPJLJRIBHYMAOX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methanol;tridecanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;tridecanedioic acid?
The IUPAC name of methanol;tridecanedioic acid (CID 175511493) is methanol;tridecanedioic acid.
What is the SMILES notation for methanol;tridecanedioic acid?
The canonical SMILES for methanol;tridecanedioic acid is CO.O=C(O)CCCCCCCCCCCC(=O)O.
What is the InChIKey of methanol;tridecanedioic acid?
The InChIKey is QPJLJRIBHYMAOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O4.CH4O/c14-12(15)10-8-6-4-2-1-3-5-7-9-11-13(16)17;1-2/h1-11H2,(H,14,15)(H,16,17);2H,1H3.
What are the key properties of methanol;tridecanedioic acid?
methanol;tridecanedioic acid has a molecular weight of 276.37 g/mol, XLogP of 3.06, 12 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;tridecanedioic acid is sourced from PubChem (CID 175511493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).