About 4-oxotetradecanamide
4-oxotetradecanamide (PubChem CID 176888940) has the molecular formula C14H27NO2
and a molecular weight of 241.37 g/mol. Its IUPAC name is 4-oxotetradecanamide.
Molecular Properties
| Compound Name | 4-oxotetradecanamide |
| PubChem CID | 176888940 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | 4-oxotetradecanamide |
| SMILES | CCCCCCCCCCC(=O)CCC(N)=O |
| InChI | InChI=1S/C14H27NO2/c1-2-3-4-5-6-7-8-9-10-13(16)11-12-14(15)17/h2-12H2,1H3,(H2,15,17) |
| InChIKey | DDHRCSNGSFSCDI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-oxotetradecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxotetradecanamide?
The IUPAC name of 4-oxotetradecanamide (CID 176888940) is 4-oxotetradecanamide.
What is the SMILES notation for 4-oxotetradecanamide?
The canonical SMILES for 4-oxotetradecanamide is CCCCCCCCCCC(=O)CCC(N)=O.
What is the InChIKey of 4-oxotetradecanamide?
The InChIKey is DDHRCSNGSFSCDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO2/c1-2-3-4-5-6-7-8-9-10-13(16)11-12-14(15)17/h2-12H2,1H3,(H2,15,17).
What are the key properties of 4-oxotetradecanamide?
4-oxotetradecanamide has a molecular weight of 241.37 g/mol, XLogP of 3.35, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxotetradecanamide is sourced from PubChem (CID 176888940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).