C25H45NO4 — CID 163693640
11-(4-aminobutyl)henicosane-2,9,12,19-tetrone (PubChem CID 163693640) has the molecular formula C25H45NO4 and a molecular weight of 423.64 g/mol. Its IUPAC name is 11-(4-aminobutyl)henicosane-2,9,12,19-tetrone.
| Compound Name | 11-(4-aminobutyl)henicosane-2,9,12,19-tetrone |
|---|---|
| PubChem CID | 163693640 |
| Molecular Formula | C25H45NO4 |
| Molecular Weight | 423.64 g/mol |
| Exact Mass | 423.33 |
| IUPAC Name | 11-(4-aminobutyl)henicosane-2,9,12,19-tetrone |
| SMILES | CCC(=O)CCCCCCC(=O)C(CCCCN)CC(=O)CCCCCCC(C)=O |
| InChI | InChI=1S/C25H45NO4/c1-3-23(28)16-9-6-7-11-18-25(30)22(15-12-13-19-26)20-24(29)17-10-5-4-8-14-21(2)27/h22H,3-20,26H2,1-2H3 |
| InChIKey | OEOJWEXFCJQKHL-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.64 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|