About (3S)-3-aminoundecane-2,9-dione
(3S)-3-aminoundecane-2,9-dione (PubChem CID 148839673) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is (3S)-3-aminoundecane-2,9-dione.
Molecular Properties
| Compound Name | (3S)-3-aminoundecane-2,9-dione |
| PubChem CID | 148839673 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | (3S)-3-aminoundecane-2,9-dione |
| SMILES | CCC(=O)CCCCC[C@H](N)C(C)=O |
| InChI | InChI=1S/C11H21NO2/c1-3-10(14)7-5-4-6-8-11(12)9(2)13/h11H,3-8,12H2,1-2H3/t11-/m0/s1 |
| InChIKey | OVHKICZDQTZDLC-NSHDSACASA-N |
| XLogP | 1.83 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-aminoundecane-2,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-aminoundecane-2,9-dione?
The IUPAC name of (3S)-3-aminoundecane-2,9-dione (CID 148839673) is (3S)-3-aminoundecane-2,9-dione.
What is the SMILES notation for (3S)-3-aminoundecane-2,9-dione?
The canonical SMILES for (3S)-3-aminoundecane-2,9-dione is CCC(=O)CCCCC[C@H](N)C(C)=O.
What is the InChIKey of (3S)-3-aminoundecane-2,9-dione?
The InChIKey is OVHKICZDQTZDLC-NSHDSACASA-N. The full InChI is InChI=1S/C11H21NO2/c1-3-10(14)7-5-4-6-8-11(12)9(2)13/h11H,3-8,12H2,1-2H3/t11-/m0/s1.
What are the key properties of (3S)-3-aminoundecane-2,9-dione?
(3S)-3-aminoundecane-2,9-dione has a molecular weight of 199.29 g/mol, XLogP of 1.83, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-aminoundecane-2,9-dione is sourced from PubChem (CID 148839673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).