About 10,10-diaminodecan-5-one
10,10-diaminodecan-5-one (PubChem CID 87142350) has the molecular formula C10H22N2O
and a molecular weight of 186.30 g/mol. Its IUPAC name is 10,10-diaminodecan-5-one.
Molecular Properties
| Compound Name | 10,10-diaminodecan-5-one |
| PubChem CID | 87142350 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 10,10-diaminodecan-5-one |
| SMILES | CCCCC(=O)CCCCC(N)N |
| InChI | InChI=1S/C10H22N2O/c1-2-3-6-9(13)7-4-5-8-10(11)12/h10H,2-8,11-12H2,1H3 |
| InChIKey | BKXJRUJPYCSKFI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 10,10-diaminodecan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10,10-diaminodecan-5-one?
The IUPAC name of 10,10-diaminodecan-5-one (CID 87142350) is 10,10-diaminodecan-5-one.
What is the SMILES notation for 10,10-diaminodecan-5-one?
The canonical SMILES for 10,10-diaminodecan-5-one is CCCCC(=O)CCCCC(N)N.
What is the InChIKey of 10,10-diaminodecan-5-one?
The InChIKey is BKXJRUJPYCSKFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O/c1-2-3-6-9(13)7-4-5-8-10(11)12/h10H,2-8,11-12H2,1H3.
What are the key properties of 10,10-diaminodecan-5-one?
10,10-diaminodecan-5-one has a molecular weight of 186.30 g/mol, XLogP of 1.55, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10,10-diaminodecan-5-one is sourced from PubChem (CID 87142350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).