About hexane-1,1-diamine;hydrobromide
hexane-1,1-diamine;hydrobromide (PubChem CID 141245501) has the molecular formula C6H17BrN2
and a molecular weight of 197.12 g/mol. Its IUPAC name is hexane-1,1-diamine;hydrobromide.
Molecular Properties
| Compound Name | hexane-1,1-diamine;hydrobromide |
| PubChem CID | 141245501 |
| Molecular Formula | C6H17BrN2 |
| Molecular Weight | 197.12 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | hexane-1,1-diamine;hydrobromide |
| SMILES | Br.CCCCCC(N)N |
| InChI | InChI=1S/C6H16N2.BrH/c1-2-3-4-5-6(7)8;/h6H,2-5,7-8H2,1H3;1H |
| InChIKey | UDIDRLGYXWETCO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.12 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze hexane-1,1-diamine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexane-1,1-diamine;hydrobromide?
The IUPAC name of hexane-1,1-diamine;hydrobromide (CID 141245501) is hexane-1,1-diamine;hydrobromide.
What is the SMILES notation for hexane-1,1-diamine;hydrobromide?
The canonical SMILES for hexane-1,1-diamine;hydrobromide is Br.CCCCCC(N)N.
What is the InChIKey of hexane-1,1-diamine;hydrobromide?
The InChIKey is UDIDRLGYXWETCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N2.BrH/c1-2-3-4-5-6(7)8;/h6H,2-5,7-8H2,1H3;1H.
What are the key properties of hexane-1,1-diamine;hydrobromide?
hexane-1,1-diamine;hydrobromide has a molecular weight of 197.12 g/mol, XLogP of 1.39, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexane-1,1-diamine;hydrobromide is sourced from PubChem (CID 141245501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).