C12H30N4 — CID 57282204
dodecane-1,1,12,12-tetramine (PubChem CID 57282204) has the molecular formula C12H30N4 and a molecular weight of 230.40 g/mol. Its IUPAC name is dodecane-1,1,12,12-tetramine.
| Compound Name | dodecane-1,1,12,12-tetramine |
|---|---|
| PubChem CID | 57282204 |
| Molecular Formula | C12H30N4 |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.25 |
| IUPAC Name | dodecane-1,1,12,12-tetramine |
| SMILES | NC(N)CCCCCCCCCCC(N)N |
| InChI | InChI=1S/C12H30N4/c13-11(14)9-7-5-3-1-2-4-6-8-10-12(15)16/h11-12H,1-10,13-16H2 |
| InChIKey | SGIYUWGZPPSQPG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|