About 8,8-diaminooctan-1-ol
8,8-diaminooctan-1-ol (PubChem CID 150598575) has the molecular formula C8H20N2O
and a molecular weight of 160.26 g/mol. Its IUPAC name is 8,8-diaminooctan-1-ol.
Molecular Properties
| Compound Name | 8,8-diaminooctan-1-ol |
| PubChem CID | 150598575 |
| Molecular Formula | C8H20N2O |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.16 |
| IUPAC Name | 8,8-diaminooctan-1-ol |
| SMILES | NC(N)CCCCCCCO |
| InChI | InChI=1S/C8H20N2O/c9-8(10)6-4-2-1-3-5-7-11/h8,11H,1-7,9-10H2 |
| InChIKey | IRJRUHLVZNTFIU-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 8,8-diaminooctan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,8-diaminooctan-1-ol?
The IUPAC name of 8,8-diaminooctan-1-ol (CID 150598575) is 8,8-diaminooctan-1-ol.
What is the SMILES notation for 8,8-diaminooctan-1-ol?
The canonical SMILES for 8,8-diaminooctan-1-ol is NC(N)CCCCCCCO.
What is the InChIKey of 8,8-diaminooctan-1-ol?
The InChIKey is IRJRUHLVZNTFIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N2O/c9-8(10)6-4-2-1-3-5-7-11/h8,11H,1-7,9-10H2.
What are the key properties of 8,8-diaminooctan-1-ol?
8,8-diaminooctan-1-ol has a molecular weight of 160.26 g/mol, XLogP of 0.56, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8,8-diaminooctan-1-ol is sourced from PubChem (CID 150598575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).