About 4-aminononane-1,9-diol
4-aminononane-1,9-diol (PubChem CID 54004768) has the molecular formula C9H21NO2
and a molecular weight of 175.27 g/mol. Its IUPAC name is 4-aminononane-1,9-diol.
Molecular Properties
| Compound Name | 4-aminononane-1,9-diol |
| PubChem CID | 54004768 |
| Molecular Formula | C9H21NO2 |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.16 |
| IUPAC Name | 4-aminononane-1,9-diol |
| SMILES | NC(CCCO)CCCCCO |
| InChI | InChI=1S/C9H21NO2/c10-9(6-4-8-12)5-2-1-3-7-11/h9,11-12H,1-8,10H2 |
| InChIKey | WIMJMHCLODTGBF-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-aminononane-1,9-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminononane-1,9-diol?
The IUPAC name of 4-aminononane-1,9-diol (CID 54004768) is 4-aminononane-1,9-diol.
What is the SMILES notation for 4-aminononane-1,9-diol?
The canonical SMILES for 4-aminononane-1,9-diol is NC(CCCO)CCCCCO.
What is the InChIKey of 4-aminononane-1,9-diol?
The InChIKey is WIMJMHCLODTGBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21NO2/c10-9(6-4-8-12)5-2-1-3-7-11/h9,11-12H,1-8,10H2.
What are the key properties of 4-aminononane-1,9-diol?
4-aminononane-1,9-diol has a molecular weight of 175.27 g/mol, XLogP of 0.64, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminononane-1,9-diol is sourced from PubChem (CID 54004768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).