C7H17NO3 — CID 87845993
1-aminoheptane-1,2,7-triol (PubChem CID 87845993) has the molecular formula C7H17NO3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 1-aminoheptane-1,2,7-triol.
| Compound Name | 1-aminoheptane-1,2,7-triol |
|---|---|
| PubChem CID | 87845993 |
| Molecular Formula | C7H17NO3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | 1-aminoheptane-1,2,7-triol |
| SMILES | NC(O)C(O)CCCCCO |
| InChI | InChI=1S/C7H17NO3/c8-7(11)6(10)4-2-1-3-5-9/h6-7,9-11H,1-5,8H2 |
| InChIKey | QDQRGJDFRIOVIS-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|