C16H34O3 — CID 11403100
hexadecane-1,8,16-triol (PubChem CID 11403100) has the molecular formula C16H34O3 and a molecular weight of 274.44 g/mol. Its IUPAC name is hexadecane-1,8,16-triol.
| Compound Name | hexadecane-1,8,16-triol |
|---|---|
| PubChem CID | 11403100 |
| Molecular Formula | C16H34O3 |
| Molecular Weight | 274.44 g/mol |
| Exact Mass | 274.25 |
| IUPAC Name | hexadecane-1,8,16-triol |
| SMILES | OCCCCCCCCC(O)CCCCCCCO |
| InChI | InChI=1S/C16H34O3/c17-14-10-6-2-1-4-8-12-16(19)13-9-5-3-7-11-15-18/h16-19H,1-15H2 |
| InChIKey | ZXSWHIBNTACELR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|