C18H38O3 — CID 90439804
octadecane-1,3,18-triol (PubChem CID 90439804) has the molecular formula C18H38O3 and a molecular weight of 302.50 g/mol. Its IUPAC name is octadecane-1,3,18-triol.
| Compound Name | octadecane-1,3,18-triol |
|---|---|
| PubChem CID | 90439804 |
| Molecular Formula | C18H38O3 |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.28 |
| IUPAC Name | octadecane-1,3,18-triol |
| SMILES | OCCCCCCCCCCCCCCCC(O)CCO |
| InChI | InChI=1S/C18H38O3/c19-16-13-11-9-7-5-3-1-2-4-6-8-10-12-14-18(21)15-17-20/h18-21H,1-17H2 |
| InChIKey | PTYZNIMPOBOYAF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|