C11H24O4 — CID 123331969
undecane-1,1,9,11-tetrol (PubChem CID 123331969) has the molecular formula C11H24O4 and a molecular weight of 220.31 g/mol. Its IUPAC name is undecane-1,1,9,11-tetrol.
| Compound Name | undecane-1,1,9,11-tetrol |
|---|---|
| PubChem CID | 123331969 |
| Molecular Formula | C11H24O4 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | undecane-1,1,9,11-tetrol |
| SMILES | OCCC(O)CCCCCCCC(O)O |
| InChI | InChI=1S/C11H24O4/c12-9-8-10(13)6-4-2-1-3-5-7-11(14)15/h10-15H,1-9H2 |
| InChIKey | PRNVFNLSNCJJBQ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|