About 14-ethoxytetradecane-1,3-diol
14-ethoxytetradecane-1,3-diol (PubChem CID 57222760) has the molecular formula C16H34O3
and a molecular weight of 274.44 g/mol. Its IUPAC name is 14-ethoxytetradecane-1,3-diol.
Molecular Properties
| Compound Name | 14-ethoxytetradecane-1,3-diol |
| PubChem CID | 57222760 |
| Molecular Formula | C16H34O3 |
| Molecular Weight | 274.44 g/mol |
| Exact Mass | 274.25 |
| IUPAC Name | 14-ethoxytetradecane-1,3-diol |
| SMILES | CCOCCCCCCCCCCCC(O)CCO |
| InChI | InChI=1S/C16H34O3/c1-2-19-15-11-9-7-5-3-4-6-8-10-12-16(18)13-14-17/h16-18H,2-15H2,1H3 |
| InChIKey | KBICFDHHZTZDFF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 14-ethoxytetradecane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 14-ethoxytetradecane-1,3-diol?
The IUPAC name of 14-ethoxytetradecane-1,3-diol (CID 57222760) is 14-ethoxytetradecane-1,3-diol.
What is the SMILES notation for 14-ethoxytetradecane-1,3-diol?
The canonical SMILES for 14-ethoxytetradecane-1,3-diol is CCOCCCCCCCCCCCC(O)CCO.
What is the InChIKey of 14-ethoxytetradecane-1,3-diol?
The InChIKey is KBICFDHHZTZDFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O3/c1-2-19-15-11-9-7-5-3-4-6-8-10-12-16(18)13-14-17/h16-18H,2-15H2,1H3.
What are the key properties of 14-ethoxytetradecane-1,3-diol?
14-ethoxytetradecane-1,3-diol has a molecular weight of 274.44 g/mol, XLogP of 3.67, 15 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 14-ethoxytetradecane-1,3-diol is sourced from PubChem (CID 57222760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).