About 5-ethoxypentane-1,3-diol
5-ethoxypentane-1,3-diol (PubChem CID 87719157) has the molecular formula C7H16O3
and a molecular weight of 148.20 g/mol. Its IUPAC name is 5-ethoxypentane-1,3-diol.
Molecular Properties
| Compound Name | 5-ethoxypentane-1,3-diol |
| PubChem CID | 87719157 |
| Molecular Formula | C7H16O3 |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.11 |
| IUPAC Name | 5-ethoxypentane-1,3-diol |
| SMILES | CCOCCC(O)CCO |
| InChI | InChI=1S/C7H16O3/c1-2-10-6-4-7(9)3-5-8/h7-9H,2-6H2,1H3 |
| InChIKey | PELKBQRAQJNMSV-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-ethoxypentane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxypentane-1,3-diol?
The IUPAC name of 5-ethoxypentane-1,3-diol (CID 87719157) is 5-ethoxypentane-1,3-diol.
What is the SMILES notation for 5-ethoxypentane-1,3-diol?
The canonical SMILES for 5-ethoxypentane-1,3-diol is CCOCCC(O)CCO.
What is the InChIKey of 5-ethoxypentane-1,3-diol?
The InChIKey is PELKBQRAQJNMSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O3/c1-2-10-6-4-7(9)3-5-8/h7-9H,2-6H2,1H3.
What are the key properties of 5-ethoxypentane-1,3-diol?
5-ethoxypentane-1,3-diol has a molecular weight of 148.20 g/mol, XLogP of 0.16, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxypentane-1,3-diol is sourced from PubChem (CID 87719157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).