About hexane-1,3-diol;hydrochloride
hexane-1,3-diol;hydrochloride (PubChem CID 141150111) has the molecular formula C6H15ClO2
and a molecular weight of 154.64 g/mol. Its IUPAC name is hexane-1,3-diol;hydrochloride.
Molecular Properties
| Compound Name | hexane-1,3-diol;hydrochloride |
| PubChem CID | 141150111 |
| Molecular Formula | C6H15ClO2 |
| Molecular Weight | 154.64 g/mol |
| Exact Mass | 154.08 |
| IUPAC Name | hexane-1,3-diol;hydrochloride |
| SMILES | CCCC(O)CCO.Cl |
| InChI | InChI=1S/C6H14O2.ClH/c1-2-3-6(8)4-5-7;/h6-8H,2-5H2,1H3;1H |
| InChIKey | NDGAPOCPCUAVQO-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.64 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze hexane-1,3-diol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexane-1,3-diol;hydrochloride?
The IUPAC name of hexane-1,3-diol;hydrochloride (CID 141150111) is hexane-1,3-diol;hydrochloride.
What is the SMILES notation for hexane-1,3-diol;hydrochloride?
The canonical SMILES for hexane-1,3-diol;hydrochloride is CCCC(O)CCO.Cl.
What is the InChIKey of hexane-1,3-diol;hydrochloride?
The InChIKey is NDGAPOCPCUAVQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O2.ClH/c1-2-3-6(8)4-5-7;/h6-8H,2-5H2,1H3;1H.
What are the key properties of hexane-1,3-diol;hydrochloride?
hexane-1,3-diol;hydrochloride has a molecular weight of 154.64 g/mol, XLogP of 0.95, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexane-1,3-diol;hydrochloride is sourced from PubChem (CID 141150111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).