About hexan-3-ol;λ2-plumbane
hexan-3-ol;λ2-plumbane (PubChem CID 174675580) has the molecular formula C6H16OPb
and a molecular weight of 311.39 g/mol. Its IUPAC name is hexan-3-ol;λ2-plumbane.
Molecular Properties
| Compound Name | hexan-3-ol;λ2-plumbane |
| PubChem CID | 174675580 |
| Molecular Formula | C6H16OPb |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | hexan-3-ol;λ2-plumbane |
| SMILES | CCCC(O)CC.[PbH2] |
| InChI | InChI=1S/C6H14O.Pb.2H/c1-3-5-6(7)4-2;;;/h6-7H,3-5H2,1-2H3;;; |
| InChIKey | FCFSBVXGJHFIHS-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze hexan-3-ol;λ2-plumbane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexan-3-ol;λ2-plumbane?
The IUPAC name of hexan-3-ol;λ2-plumbane (CID 174675580) is hexan-3-ol;λ2-plumbane.
What is the SMILES notation for hexan-3-ol;λ2-plumbane?
The canonical SMILES for hexan-3-ol;λ2-plumbane is CCCC(O)CC.[PbH2].
What is the InChIKey of hexan-3-ol;λ2-plumbane?
The InChIKey is FCFSBVXGJHFIHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O.Pb.2H/c1-3-5-6(7)4-2;;;/h6-7H,3-5H2,1-2H3;;;.
What are the key properties of hexan-3-ol;λ2-plumbane?
hexan-3-ol;λ2-plumbane has a molecular weight of 311.39 g/mol, XLogP of 0.64, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexan-3-ol;λ2-plumbane is sourced from PubChem (CID 174675580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).