C13H30O — CID 143653257
2,3-dimethylpentane;hexan-3-ol (PubChem CID 143653257) has the molecular formula C13H30O and a molecular weight of 202.38 g/mol. Its IUPAC name is 2,3-dimethylpentane;hexan-3-ol.
| Compound Name | 2,3-dimethylpentane;hexan-3-ol |
|---|---|
| PubChem CID | 143653257 |
| Molecular Formula | C13H30O |
| Molecular Weight | 202.38 g/mol |
| Exact Mass | 202.23 |
| IUPAC Name | 2,3-dimethylpentane;hexan-3-ol |
| SMILES | CCC(C)C(C)C.CCCC(O)CC |
| InChI | InChI=1S/C7H16.C6H14O/c1-5-7(4)6(2)3;1-3-5-6(7)4-2/h6-7H,5H2,1-4H3;6-7H,3-5H2,1-2H3 |
| InChIKey | HCCFCPIWNPYNRL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |