About 3-methylnonan-4-ol;nonan-4-ol
3-methylnonan-4-ol;nonan-4-ol (PubChem CID 18968461) has the molecular formula C19H42O2
and a molecular weight of 302.54 g/mol. Its IUPAC name is 3-methylnonan-4-ol;nonan-4-ol.
Molecular Properties
| Compound Name | 3-methylnonan-4-ol;nonan-4-ol |
| PubChem CID | 18968461 |
| Molecular Formula | C19H42O2 |
| Molecular Weight | 302.54 g/mol |
| Exact Mass | 302.32 |
| IUPAC Name | 3-methylnonan-4-ol;nonan-4-ol |
| SMILES | CCCCCC(O)C(C)CC.CCCCCC(O)CCC |
| InChI | InChI=1S/C10H22O.C9H20O/c1-4-6-7-8-10(11)9(3)5-2;1-3-5-6-8-9(10)7-4-2/h9-11H,4-8H2,1-3H3;9-10H,3-8H2,1-2H3 |
| InChIKey | ICKGQAYSMWNWGP-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.54 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methylnonan-4-ol;nonan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylnonan-4-ol;nonan-4-ol?
The IUPAC name of 3-methylnonan-4-ol;nonan-4-ol (CID 18968461) is 3-methylnonan-4-ol;nonan-4-ol.
What is the SMILES notation for 3-methylnonan-4-ol;nonan-4-ol?
The canonical SMILES for 3-methylnonan-4-ol;nonan-4-ol is CCCCCC(O)C(C)CC.CCCCCC(O)CCC.
What is the InChIKey of 3-methylnonan-4-ol;nonan-4-ol?
The InChIKey is ICKGQAYSMWNWGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O.C9H20O/c1-4-6-7-8-10(11)9(3)5-2;1-3-5-6-8-9(10)7-4-2/h9-11H,4-8H2,1-3H3;9-10H,3-8H2,1-2H3.
What are the key properties of 3-methylnonan-4-ol;nonan-4-ol?
3-methylnonan-4-ol;nonan-4-ol has a molecular weight of 302.54 g/mol, XLogP of 5.70, 12 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylnonan-4-ol;nonan-4-ol is sourced from PubChem (CID 18968461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).