About decane-3,7-diol;decan-4-ol;nonan-4-ol
decane-3,7-diol;decan-4-ol;nonan-4-ol (PubChem CID 159957701) has the molecular formula C29H64O4
and a molecular weight of 476.83 g/mol. Its IUPAC name is decane-3,7-diol;decan-4-ol;nonan-4-ol.
Molecular Properties
| Compound Name | decane-3,7-diol;decan-4-ol;nonan-4-ol |
| PubChem CID | 159957701 |
| Molecular Formula | C29H64O4 |
| Molecular Weight | 476.83 g/mol |
| Exact Mass | 476.48 |
| IUPAC Name | decane-3,7-diol;decan-4-ol;nonan-4-ol |
| SMILES | CCCC(O)CCCC(O)CC.CCCCCC(O)CCC.CCCCCCC(O)CCC |
| InChI | InChI=1S/C10H22O2.C10H22O.C9H20O/c1-3-6-10(12)8-5-7-9(11)4-2;1-3-5-6-7-9-10(11)8-4-2;1-3-5-6-8-9(10)7-4-2/h9-12H,3-8H2,1-2H3;10-11H,3-9H2,1-2H3;9-10H,3-8H2,1-2H3 |
| InChIKey | OCXRDETXGWCVSP-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.83 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decane-3,7-diol;decan-4-ol;nonan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decane-3,7-diol;decan-4-ol;nonan-4-ol?
The IUPAC name of decane-3,7-diol;decan-4-ol;nonan-4-ol (CID 159957701) is decane-3,7-diol;decan-4-ol;nonan-4-ol.
What is the SMILES notation for decane-3,7-diol;decan-4-ol;nonan-4-ol?
The canonical SMILES for decane-3,7-diol;decan-4-ol;nonan-4-ol is CCCC(O)CCCC(O)CC.CCCCCC(O)CCC.CCCCCCC(O)CCC.
What is the InChIKey of decane-3,7-diol;decan-4-ol;nonan-4-ol?
The InChIKey is OCXRDETXGWCVSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O2.C10H22O.C9H20O/c1-3-6-10(12)8-5-7-9(11)4-2;1-3-5-6-7-9-10(11)8-4-2;1-3-5-6-8-9(10)7-4-2/h9-12H,3-8H2,1-2H3;10-11H,3-9H2,1-2H3;9-10H,3-8H2,1-2H3.
What are the key properties of decane-3,7-diol;decan-4-ol;nonan-4-ol?
decane-3,7-diol;decan-4-ol;nonan-4-ol has a molecular weight of 476.83 g/mol, XLogP of 7.93, 20 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for decane-3,7-diol;decan-4-ol;nonan-4-ol is sourced from PubChem (CID 159957701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).