About dodecan-3-ol;propane
dodecan-3-ol;propane (PubChem CID 159624658) has the molecular formula C15H34O
and a molecular weight of 230.44 g/mol. Its IUPAC name is dodecan-3-ol;propane.
Molecular Properties
| Compound Name | dodecan-3-ol;propane |
| PubChem CID | 159624658 |
| Molecular Formula | C15H34O |
| Molecular Weight | 230.44 g/mol |
| Exact Mass | 230.26 |
| IUPAC Name | dodecan-3-ol;propane |
| SMILES | CCC.CCCCCCCCCC(O)CC |
| InChI | InChI=1S/C12H26O.C3H8/c1-3-5-6-7-8-9-10-11-12(13)4-2;1-3-2/h12-13H,3-11H2,1-2H3;3H2,1-2H3 |
| InChIKey | MOIGYMYPOIFTPX-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 230.44 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dodecan-3-ol;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecan-3-ol;propane?
The IUPAC name of dodecan-3-ol;propane (CID 159624658) is dodecan-3-ol;propane.
What is the SMILES notation for dodecan-3-ol;propane?
The canonical SMILES for dodecan-3-ol;propane is CCC.CCCCCCCCCC(O)CC.
What is the InChIKey of dodecan-3-ol;propane?
The InChIKey is MOIGYMYPOIFTPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O.C3H8/c1-3-5-6-7-8-9-10-11-12(13)4-2;1-3-2/h12-13H,3-11H2,1-2H3;3H2,1-2H3.
What are the key properties of dodecan-3-ol;propane?
dodecan-3-ol;propane has a molecular weight of 230.44 g/mol, XLogP of 5.31, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dodecan-3-ol;propane is sourced from PubChem (CID 159624658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).