About CID 175329168
CID 175329168 (PubChem CID 175329168) has the molecular formula C15H33I2NO
and a molecular weight of 497.24 g/mol.
Molecular Properties
| Compound Name | CID 175329168 |
| PubChem CID | 175329168 |
| Molecular Formula | C15H33I2NO |
| Molecular Weight | 497.24 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | — |
| SMILES | CCCCCCCCCCCCC(O)CC.INI |
| InChI | InChI=1S/C15H32O.HI2N/c1-3-5-6-7-8-9-10-11-12-13-14-15(16)4-2;1-3-2/h15-16H,3-14H2,1-2H3;3H |
| InChIKey | GMLLVKILBRHSRD-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 497.24 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze CID 175329168 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175329168?
The IUPAC name of CID 175329168 (CID 175329168) is not available.
What is the SMILES notation for CID 175329168?
The canonical SMILES for CID 175329168 is CCCCCCCCCCCCC(O)CC.INI.
What is the InChIKey of CID 175329168?
The InChIKey is GMLLVKILBRHSRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32O.HI2N/c1-3-5-6-7-8-9-10-11-12-13-14-15(16)4-2;1-3-2/h15-16H,3-14H2,1-2H3;3H.
What are the key properties of CID 175329168?
CID 175329168 has a molecular weight of 497.24 g/mol, XLogP of 6.34, 12 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175329168 is sourced from PubChem (CID 175329168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).