About octan-3-ol;propan-2-ol;silane
octan-3-ol;propan-2-ol;silane (PubChem CID 174446163) has the molecular formula C11H30O2Si
and a molecular weight of 222.44 g/mol. Its IUPAC name is octan-3-ol;propan-2-ol;silane.
Molecular Properties
| Compound Name | octan-3-ol;propan-2-ol;silane |
| PubChem CID | 174446163 |
| Molecular Formula | C11H30O2Si |
| Molecular Weight | 222.44 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | octan-3-ol;propan-2-ol;silane |
| SMILES | CC(C)O.CCCCCC(O)CC.[SiH4] |
| InChI | InChI=1S/C8H18O.C3H8O.H4Si/c1-3-5-6-7-8(9)4-2;1-3(2)4;/h8-9H,3-7H2,1-2H3;3-4H,1-2H3;1H4 |
| InChIKey | YHBMSRYRBOVHBX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.44 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze octan-3-ol;propan-2-ol;silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octan-3-ol;propan-2-ol;silane?
The IUPAC name of octan-3-ol;propan-2-ol;silane (CID 174446163) is octan-3-ol;propan-2-ol;silane.
What is the SMILES notation for octan-3-ol;propan-2-ol;silane?
The canonical SMILES for octan-3-ol;propan-2-ol;silane is CC(C)O.CCCCCC(O)CC.[SiH4].
What is the InChIKey of octan-3-ol;propan-2-ol;silane?
The InChIKey is YHBMSRYRBOVHBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O.C3H8O.H4Si/c1-3-5-6-7-8(9)4-2;1-3(2)4;/h8-9H,3-7H2,1-2H3;3-4H,1-2H3;1H4.
What are the key properties of octan-3-ol;propan-2-ol;silane?
octan-3-ol;propan-2-ol;silane has a molecular weight of 222.44 g/mol, XLogP of 1.27, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for octan-3-ol;propan-2-ol;silane is sourced from PubChem (CID 174446163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).