About heptan-2-ol;heptan-3-ol
heptan-2-ol;heptan-3-ol (PubChem CID 156500296) has the molecular formula C14H32O2
and a molecular weight of 232.41 g/mol. Its IUPAC name is heptan-2-ol;heptan-3-ol.
Molecular Properties
| Compound Name | heptan-2-ol;heptan-3-ol |
| PubChem CID | 156500296 |
| Molecular Formula | C14H32O2 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.24 |
| IUPAC Name | heptan-2-ol;heptan-3-ol |
| SMILES | CCCCC(O)CC.CCCCCC(C)O |
| InChI | InChI=1S/2C7H16O/c1-3-4-5-6-7(2)8;1-3-5-6-7(8)4-2/h2*7-8H,3-6H2,1-2H3 |
| InChIKey | MPHHFQYWBDXNRR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze heptan-2-ol;heptan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptan-2-ol;heptan-3-ol?
The IUPAC name of heptan-2-ol;heptan-3-ol (CID 156500296) is heptan-2-ol;heptan-3-ol.
What is the SMILES notation for heptan-2-ol;heptan-3-ol?
The canonical SMILES for heptan-2-ol;heptan-3-ol is CCCCC(O)CC.CCCCCC(C)O.
What is the InChIKey of heptan-2-ol;heptan-3-ol?
The InChIKey is MPHHFQYWBDXNRR-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H16O/c1-3-4-5-6-7(2)8;1-3-5-6-7(8)4-2/h2*7-8H,3-6H2,1-2H3.
What are the key properties of heptan-2-ol;heptan-3-ol?
heptan-2-ol;heptan-3-ol has a molecular weight of 232.41 g/mol, XLogP of 3.89, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for heptan-2-ol;heptan-3-ol is sourced from PubChem (CID 156500296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).