About octadecane-2,14-diol
octadecane-2,14-diol (PubChem CID 170722506) has the molecular formula C18H38O2
and a molecular weight of 286.50 g/mol. Its IUPAC name is octadecane-2,14-diol.
Molecular Properties
| Compound Name | octadecane-2,14-diol |
| PubChem CID | 170722506 |
| Molecular Formula | C18H38O2 |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.29 |
| IUPAC Name | octadecane-2,14-diol |
| SMILES | CCCCC(O)CCCCCCCCCCCC(C)O |
| InChI | InChI=1S/C18H38O2/c1-3-4-15-18(20)16-13-11-9-7-5-6-8-10-12-14-17(2)19/h17-20H,3-16H2,1-2H3 |
| InChIKey | CYZNVYKZHMIITA-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octadecane-2,14-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadecane-2,14-diol?
The IUPAC name of octadecane-2,14-diol (CID 170722506) is octadecane-2,14-diol.
What is the SMILES notation for octadecane-2,14-diol?
The canonical SMILES for octadecane-2,14-diol is CCCCC(O)CCCCCCCCCCCC(C)O.
What is the InChIKey of octadecane-2,14-diol?
The InChIKey is CYZNVYKZHMIITA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38O2/c1-3-4-15-18(20)16-13-11-9-7-5-6-8-10-12-14-17(2)19/h17-20H,3-16H2,1-2H3.
What are the key properties of octadecane-2,14-diol?
octadecane-2,14-diol has a molecular weight of 286.50 g/mol, XLogP of 5.21, 15 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for octadecane-2,14-diol is sourced from PubChem (CID 170722506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).