About hexadecan-5-ol;propane-1,2-diol
hexadecan-5-ol;propane-1,2-diol (PubChem CID 162138861) has the molecular formula C19H42O3
and a molecular weight of 318.54 g/mol. Its IUPAC name is hexadecan-5-ol;propane-1,2-diol.
Molecular Properties
| Compound Name | hexadecan-5-ol;propane-1,2-diol |
| PubChem CID | 162138861 |
| Molecular Formula | C19H42O3 |
| Molecular Weight | 318.54 g/mol |
| Exact Mass | 318.31 |
| IUPAC Name | hexadecan-5-ol;propane-1,2-diol |
| SMILES | CC(O)CO.CCCCCCCCCCCC(O)CCCC |
| InChI | InChI=1S/C16H34O.C3H8O2/c1-3-5-7-8-9-10-11-12-13-15-16(17)14-6-4-2;1-3(5)2-4/h16-17H,3-15H2,1-2H3;3-5H,2H2,1H3 |
| InChIKey | ZJQVKYDZNHPJLN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexadecan-5-ol;propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexadecan-5-ol;propane-1,2-diol?
The IUPAC name of hexadecan-5-ol;propane-1,2-diol (CID 162138861) is hexadecan-5-ol;propane-1,2-diol.
What is the SMILES notation for hexadecan-5-ol;propane-1,2-diol?
The canonical SMILES for hexadecan-5-ol;propane-1,2-diol is CC(O)CO.CCCCCCCCCCCC(O)CCCC.
What is the InChIKey of hexadecan-5-ol;propane-1,2-diol?
The InChIKey is ZJQVKYDZNHPJLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O.C3H8O2/c1-3-5-7-8-9-10-11-12-13-15-16(17)14-6-4-2;1-3(5)2-4/h16-17H,3-15H2,1-2H3;3-5H,2H2,1H3.
What are the key properties of hexadecan-5-ol;propane-1,2-diol?
hexadecan-5-ol;propane-1,2-diol has a molecular weight of 318.54 g/mol, XLogP of 4.82, 14 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexadecan-5-ol;propane-1,2-diol is sourced from PubChem (CID 162138861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).