About 2-Octanol
2-Octanol (PubChem CID 20083) has the molecular formula C8H18O
and a molecular weight of 130.23 g/mol. Its IUPAC name is octan-2-ol.
Molecular Properties
| Compound Name | 2-Octanol |
| PubChem CID | 20083 |
| Molecular Formula | C8H18O |
| Molecular Weight | 130.23 g/mol |
| Exact Mass | 130.14 |
| IUPAC Name | octan-2-ol |
| SMILES | CCCCCCC(C)O |
| InChI | InChI=1S/C8H18O/c1-3-4-5-6-7-8(2)9/h8-9H,3-7H2,1-2H3 |
| InChIKey | SJWFXCIHNDVPSH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | 52 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.23 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-Octanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-Octanol?
The IUPAC name of 2-Octanol (CID 20083) is octan-2-ol.
What is the SMILES notation for 2-Octanol?
The canonical SMILES for 2-Octanol is CCCCCCC(C)O.
What is the InChIKey of 2-Octanol?
The InChIKey is SJWFXCIHNDVPSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O/c1-3-4-5-6-7-8(2)9/h8-9H,3-7H2,1-2H3.
What are the key properties of 2-Octanol?
2-Octanol has a molecular weight of 130.23 g/mol, XLogP of 2.90, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-Octanol is sourced from PubChem (CID 20083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).