About methanamine;octadecan-2-ol;hydrochloride
methanamine;octadecan-2-ol;hydrochloride (PubChem CID 173318083) has the molecular formula C19H44ClNO
and a molecular weight of 338.02 g/mol. Its IUPAC name is methanamine;octadecan-2-ol;hydrochloride.
Molecular Properties
| Compound Name | methanamine;octadecan-2-ol;hydrochloride |
| PubChem CID | 173318083 |
| Molecular Formula | C19H44ClNO |
| Molecular Weight | 338.02 g/mol |
| Exact Mass | 337.31 |
| IUPAC Name | methanamine;octadecan-2-ol;hydrochloride |
| SMILES | CCCCCCCCCCCCCCCCC(C)O.CN.Cl |
| InChI | InChI=1S/C18H38O.CH5N.ClH/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(2)19;1-2;/h18-19H,3-17H2,1-2H3;2H2,1H3;1H |
| InChIKey | ZWSORWQOVWLWMS-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.02 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methanamine;octadecan-2-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;octadecan-2-ol;hydrochloride?
The IUPAC name of methanamine;octadecan-2-ol;hydrochloride (CID 173318083) is methanamine;octadecan-2-ol;hydrochloride.
What is the SMILES notation for methanamine;octadecan-2-ol;hydrochloride?
The canonical SMILES for methanamine;octadecan-2-ol;hydrochloride is CCCCCCCCCCCCCCCCC(C)O.CN.Cl.
What is the InChIKey of methanamine;octadecan-2-ol;hydrochloride?
The InChIKey is ZWSORWQOVWLWMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38O.CH5N.ClH/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(2)19;1-2;/h18-19H,3-17H2,1-2H3;2H2,1H3;1H.
What are the key properties of methanamine;octadecan-2-ol;hydrochloride?
methanamine;octadecan-2-ol;hydrochloride has a molecular weight of 338.02 g/mol, XLogP of 6.24, 15 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;octadecan-2-ol;hydrochloride is sourced from PubChem (CID 173318083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).