About heptan-2-ol;hydroxylamine
heptan-2-ol;hydroxylamine (PubChem CID 88625997) has the molecular formula C7H19NO2
and a molecular weight of 149.23 g/mol. Its IUPAC name is heptan-2-ol;hydroxylamine.
Molecular Properties
| Compound Name | heptan-2-ol;hydroxylamine |
| PubChem CID | 88625997 |
| Molecular Formula | C7H19NO2 |
| Molecular Weight | 149.23 g/mol |
| Exact Mass | 149.14 |
| IUPAC Name | heptan-2-ol;hydroxylamine |
| SMILES | CCCCCC(C)O.NO |
| InChI | InChI=1S/C7H16O.H3NO/c1-3-4-5-6-7(2)8;1-2/h7-8H,3-6H2,1-2H3;2H,1H2 |
| InChIKey | SBFVGGQBHBTCPI-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.23 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze heptan-2-ol;hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptan-2-ol;hydroxylamine?
The IUPAC name of heptan-2-ol;hydroxylamine (CID 88625997) is heptan-2-ol;hydroxylamine.
What is the SMILES notation for heptan-2-ol;hydroxylamine?
The canonical SMILES for heptan-2-ol;hydroxylamine is CCCCCC(C)O.NO.
What is the InChIKey of heptan-2-ol;hydroxylamine?
The InChIKey is SBFVGGQBHBTCPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O.H3NO/c1-3-4-5-6-7(2)8;1-2/h7-8H,3-6H2,1-2H3;2H,1H2.
What are the key properties of heptan-2-ol;hydroxylamine?
heptan-2-ol;hydroxylamine has a molecular weight of 149.23 g/mol, XLogP of 1.28, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for heptan-2-ol;hydroxylamine is sourced from PubChem (CID 88625997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).