About docosan-2-ol
docosan-2-ol (PubChem CID 14151025) has the molecular formula C22H46O
and a molecular weight of 326.61 g/mol. Its IUPAC name is docosan-2-ol.
Molecular Properties
| Compound Name | docosan-2-ol |
| PubChem CID | 14151025 |
| Molecular Formula | C22H46O |
| Molecular Weight | 326.61 g/mol |
| Exact Mass | 326.35 |
| IUPAC Name | docosan-2-ol |
| SMILES | CCCCCCCCCCCCCCCCCCCCC(C)O |
| InChI | InChI=1S/C22H46O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(2)23/h22-23H,3-21H2,1-2H3 |
| InChIKey | MWCUCWLKNRBDOG-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.61 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze docosan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of docosan-2-ol?
The IUPAC name of docosan-2-ol (CID 14151025) is docosan-2-ol.
What is the SMILES notation for docosan-2-ol?
The canonical SMILES for docosan-2-ol is CCCCCCCCCCCCCCCCCCCCC(C)O.
What is the InChIKey of docosan-2-ol?
The InChIKey is MWCUCWLKNRBDOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H46O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(2)23/h22-23H,3-21H2,1-2H3.
What are the key properties of docosan-2-ol?
docosan-2-ol has a molecular weight of 326.61 g/mol, XLogP of 7.80, 19 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for docosan-2-ol is sourced from PubChem (CID 14151025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).