About sodium;dodecan-2-ol;hydride
sodium;dodecan-2-ol;hydride (PubChem CID 174187549) has the molecular formula C12H27NaO
and a molecular weight of 210.34 g/mol. Its IUPAC name is sodium;dodecan-2-ol;hydride.
Molecular Properties
| Compound Name | sodium;dodecan-2-ol;hydride |
| PubChem CID | 174187549 |
| Molecular Formula | C12H27NaO |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | sodium;dodecan-2-ol;hydride |
| SMILES | CCCCCCCCCCC(C)O.[H-].[Na+] |
| InChI | InChI=1S/C12H26O.Na.H/c1-3-4-5-6-7-8-9-10-11-12(2)13;;/h12-13H,3-11H2,1-2H3;;/q;+1;-1 |
| InChIKey | NQNXLQLJSQUOPJ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium;dodecan-2-ol;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;dodecan-2-ol;hydride?
The IUPAC name of sodium;dodecan-2-ol;hydride (CID 174187549) is sodium;dodecan-2-ol;hydride.
What is the SMILES notation for sodium;dodecan-2-ol;hydride?
The canonical SMILES for sodium;dodecan-2-ol;hydride is CCCCCCCCCCC(C)O.[H-].[Na+].
What is the InChIKey of sodium;dodecan-2-ol;hydride?
The InChIKey is NQNXLQLJSQUOPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O.Na.H/c1-3-4-5-6-7-8-9-10-11-12(2)13;;/h12-13H,3-11H2,1-2H3;;/q;+1;-1.
What are the key properties of sodium;dodecan-2-ol;hydride?
sodium;dodecan-2-ol;hydride has a molecular weight of 210.34 g/mol, XLogP of 1.01, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;dodecan-2-ol;hydride is sourced from PubChem (CID 174187549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).