About henicosan-2-ol
henicosan-2-ol (PubChem CID 14151023) has the molecular formula C21H44O
and a molecular weight of 312.58 g/mol. Its IUPAC name is henicosan-2-ol.
Molecular Properties
| Compound Name | henicosan-2-ol |
| PubChem CID | 14151023 |
| Molecular Formula | C21H44O |
| Molecular Weight | 312.58 g/mol |
| Exact Mass | 312.34 |
| IUPAC Name | henicosan-2-ol |
| SMILES | CCCCCCCCCCCCCCCCCCCC(C)O |
| InChI | InChI=1S/C21H44O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(2)22/h21-22H,3-20H2,1-2H3 |
| InChIKey | ZWKMKPIPURRGEC-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.58 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze henicosan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of henicosan-2-ol?
The IUPAC name of henicosan-2-ol (CID 14151023) is henicosan-2-ol.
What is the SMILES notation for henicosan-2-ol?
The canonical SMILES for henicosan-2-ol is CCCCCCCCCCCCCCCCCCCC(C)O.
What is the InChIKey of henicosan-2-ol?
The InChIKey is ZWKMKPIPURRGEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H44O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(2)22/h21-22H,3-20H2,1-2H3.
What are the key properties of henicosan-2-ol?
henicosan-2-ol has a molecular weight of 312.58 g/mol, XLogP of 7.41, 18 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for henicosan-2-ol is sourced from PubChem (CID 14151023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).