About (2S)-heptan-2-ol;hydrochloride
(2S)-heptan-2-ol;hydrochloride (PubChem CID 141119609) has the molecular formula C7H17ClO
and a molecular weight of 152.67 g/mol. Its IUPAC name is (2S)-heptan-2-ol;hydrochloride.
Molecular Properties
| Compound Name | (2S)-heptan-2-ol;hydrochloride |
| PubChem CID | 141119609 |
| Molecular Formula | C7H17ClO |
| Molecular Weight | 152.67 g/mol |
| Exact Mass | 152.10 |
| IUPAC Name | (2S)-heptan-2-ol;hydrochloride |
| SMILES | CCCCC[C@H](C)O.Cl |
| InChI | InChI=1S/C7H16O.ClH/c1-3-4-5-6-7(2)8;/h7-8H,3-6H2,1-2H3;1H/t7-;/m0./s1 |
| InChIKey | BSXGJVMFCQIOJH-FJXQXJEOSA-N |
| XLogP | 2.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.67 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-heptan-2-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-heptan-2-ol;hydrochloride?
The IUPAC name of (2S)-heptan-2-ol;hydrochloride (CID 141119609) is (2S)-heptan-2-ol;hydrochloride.
What is the SMILES notation for (2S)-heptan-2-ol;hydrochloride?
The canonical SMILES for (2S)-heptan-2-ol;hydrochloride is CCCCC[C@H](C)O.Cl.
What is the InChIKey of (2S)-heptan-2-ol;hydrochloride?
The InChIKey is BSXGJVMFCQIOJH-FJXQXJEOSA-N. The full InChI is InChI=1S/C7H16O.ClH/c1-3-4-5-6-7(2)8;/h7-8H,3-6H2,1-2H3;1H/t7-;/m0./s1.
What are the key properties of (2S)-heptan-2-ol;hydrochloride?
(2S)-heptan-2-ol;hydrochloride has a molecular weight of 152.67 g/mol, XLogP of 2.37, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-heptan-2-ol;hydrochloride is sourced from PubChem (CID 141119609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).