About (2R)-heptan-2-ol
(2R)-heptan-2-ol (PubChem CID 6992611) has the molecular formula C7H16O
and a molecular weight of 116.20 g/mol. Its IUPAC name is (2R)-heptan-2-ol.
Molecular Properties
| Compound Name | (2R)-heptan-2-ol |
| PubChem CID | 6992611 |
| Molecular Formula | C7H16O |
| Molecular Weight | 116.20 g/mol |
| Exact Mass | 116.12 |
| IUPAC Name | (2R)-heptan-2-ol |
| SMILES | CCCCC[C@@H](C)O |
| InChI | InChI=1S/C7H16O/c1-3-4-5-6-7(2)8/h7-8H,3-6H2,1-2H3/t7-/m1/s1 |
| InChIKey | CETWDUZRCINIHU-SSDOTTSWSA-N |
| XLogP | 1.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.20 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2R)-heptan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-heptan-2-ol?
The IUPAC name of (2R)-heptan-2-ol (CID 6992611) is (2R)-heptan-2-ol.
What is the SMILES notation for (2R)-heptan-2-ol?
The canonical SMILES for (2R)-heptan-2-ol is CCCCC[C@@H](C)O.
What is the InChIKey of (2R)-heptan-2-ol?
The InChIKey is CETWDUZRCINIHU-SSDOTTSWSA-N. The full InChI is InChI=1S/C7H16O/c1-3-4-5-6-7(2)8/h7-8H,3-6H2,1-2H3/t7-/m1/s1.
What are the key properties of (2R)-heptan-2-ol?
(2R)-heptan-2-ol has a molecular weight of 116.20 g/mol, XLogP of 1.95, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-heptan-2-ol is sourced from PubChem (CID 6992611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).