About azane;tetradecan-2-ol
azane;tetradecan-2-ol (PubChem CID 172733454) has the molecular formula C14H33NO
and a molecular weight of 231.42 g/mol. Its IUPAC name is azane;tetradecan-2-ol.
Molecular Properties
| Compound Name | azane;tetradecan-2-ol |
| PubChem CID | 172733454 |
| Molecular Formula | C14H33NO |
| Molecular Weight | 231.42 g/mol |
| Exact Mass | 231.26 |
| IUPAC Name | azane;tetradecan-2-ol |
| SMILES | CCCCCCCCCCCCC(C)O.N |
| InChI | InChI=1S/C14H30O.H3N/c1-3-4-5-6-7-8-9-10-11-12-13-14(2)15;/h14-15H,3-13H2,1-2H3;1H3 |
| InChIKey | ICKGCLUDGKGRGB-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.42 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze azane;tetradecan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;tetradecan-2-ol?
The IUPAC name of azane;tetradecan-2-ol (CID 172733454) is azane;tetradecan-2-ol.
What is the SMILES notation for azane;tetradecan-2-ol?
The canonical SMILES for azane;tetradecan-2-ol is CCCCCCCCCCCCC(C)O.N.
What is the InChIKey of azane;tetradecan-2-ol?
The InChIKey is ICKGCLUDGKGRGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O.H3N/c1-3-4-5-6-7-8-9-10-11-12-13-14(2)15;/h14-15H,3-13H2,1-2H3;1H3.
What are the key properties of azane;tetradecan-2-ol?
azane;tetradecan-2-ol has a molecular weight of 231.42 g/mol, XLogP of 4.84, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;tetradecan-2-ol is sourced from PubChem (CID 172733454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).