About ethane;heptan-3-ol;yttrium
ethane;heptan-3-ol;yttrium (PubChem CID 178141983) has the molecular formula C9H22OY
and a molecular weight of 235.18 g/mol. Its IUPAC name is ethane;heptan-3-ol;yttrium.
Molecular Properties
| Compound Name | ethane;heptan-3-ol;yttrium |
| PubChem CID | 178141983 |
| Molecular Formula | C9H22OY |
| Molecular Weight | 235.18 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | ethane;heptan-3-ol;yttrium |
| SMILES | CC.CCCCC(O)CC.[Y] |
| InChI | InChI=1S/C7H16O.C2H6.Y/c1-3-5-6-7(8)4-2;1-2;/h7-8H,3-6H2,1-2H3;1-2H3; |
| InChIKey | YJUYGYWEHSBUOV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.18 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;heptan-3-ol;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;heptan-3-ol;yttrium?
The IUPAC name of ethane;heptan-3-ol;yttrium (CID 178141983) is ethane;heptan-3-ol;yttrium.
What is the SMILES notation for ethane;heptan-3-ol;yttrium?
The canonical SMILES for ethane;heptan-3-ol;yttrium is CC.CCCCC(O)CC.[Y].
What is the InChIKey of ethane;heptan-3-ol;yttrium?
The InChIKey is YJUYGYWEHSBUOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O.C2H6.Y/c1-3-5-6-7(8)4-2;1-2;/h7-8H,3-6H2,1-2H3;1-2H3;.
What are the key properties of ethane;heptan-3-ol;yttrium?
ethane;heptan-3-ol;yttrium has a molecular weight of 235.18 g/mol, XLogP of 2.97, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;heptan-3-ol;yttrium is sourced from PubChem (CID 178141983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).