C11H24O2 — CID 10899409
(5R,7S)-undecane-5,7-diol (PubChem CID 10899409) has the molecular formula C11H24O2 and a molecular weight of 188.31 g/mol. Its IUPAC name is (5R,7S)-undecane-5,7-diol.
| Compound Name | (5R,7S)-undecane-5,7-diol |
|---|---|
| PubChem CID | 10899409 |
| Molecular Formula | C11H24O2 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.18 |
| IUPAC Name | (5R,7S)-undecane-5,7-diol |
| SMILES | CCCC[C@@H](O)C[C@@H](O)CCCC |
| InChI | InChI=1S/C11H24O2/c1-3-5-7-10(12)9-11(13)8-6-4-2/h10-13H,3-9H2,1-2H3/t10-,11+ |
| InChIKey | BVWSMNFXWYNCOJ-PHIMTYICSA-N |
| XLogP | 2.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |