C11H24O3 — CID 57025994
undecane-3,6,9-triol (PubChem CID 57025994) has the molecular formula C11H24O3 and a molecular weight of 204.31 g/mol. Its IUPAC name is undecane-3,6,9-triol.
| Compound Name | undecane-3,6,9-triol |
|---|---|
| PubChem CID | 57025994 |
| Molecular Formula | C11H24O3 |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.17 |
| IUPAC Name | undecane-3,6,9-triol |
| SMILES | CCC(O)CCC(O)CCC(O)CC |
| InChI | InChI=1S/C11H24O3/c1-3-9(12)5-7-11(14)8-6-10(13)4-2/h9-14H,3-8H2,1-2H3 |
| InChIKey | GHNDBWQITTYSSW-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |