C8H18O3 — CID 90779093
octane-2,3,6-triol (PubChem CID 90779093) has the molecular formula C8H18O3 and a molecular weight of 162.23 g/mol. Its IUPAC name is octane-2,3,6-triol.
| Compound Name | octane-2,3,6-triol |
|---|---|
| PubChem CID | 90779093 |
| Molecular Formula | C8H18O3 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.13 |
| IUPAC Name | octane-2,3,6-triol |
| SMILES | CCC(O)CCC(O)C(C)O |
| InChI | InChI=1S/C8H18O3/c1-3-7(10)4-5-8(11)6(2)9/h6-11H,3-5H2,1-2H3 |
| InChIKey | LMOHRCRFTAYMMY-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |