C12H28O4 — CID 175419293
hexane-2,3-diol;hexane-2,4-diol (PubChem CID 175419293) has the molecular formula C12H28O4 and a molecular weight of 236.35 g/mol. Its IUPAC name is hexane-2,3-diol;hexane-2,4-diol.
| Compound Name | hexane-2,3-diol;hexane-2,4-diol |
|---|---|
| PubChem CID | 175419293 |
| Molecular Formula | C12H28O4 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | hexane-2,3-diol;hexane-2,4-diol |
| SMILES | CCC(O)CC(C)O.CCCC(O)C(C)O |
| InChI | InChI=1S/2C6H14O2/c1-3-6(8)4-5(2)7;1-3-4-6(8)5(2)7/h2*5-8H,3-4H2,1-2H3 |
| InChIKey | TZZUPYCWGAPMQF-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |