C14H32O4 — CID 159964134
heptane-3,4-diol;heptane-3,5-diol (PubChem CID 159964134) has the molecular formula C14H32O4 and a molecular weight of 264.41 g/mol. Its IUPAC name is heptane-3,4-diol;heptane-3,5-diol.
| Compound Name | heptane-3,4-diol;heptane-3,5-diol |
|---|---|
| PubChem CID | 159964134 |
| Molecular Formula | C14H32O4 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.23 |
| IUPAC Name | heptane-3,4-diol;heptane-3,5-diol |
| SMILES | CCC(O)CC(O)CC.CCCC(O)C(O)CC |
| InChI | InChI=1S/2C7H16O2/c1-3-6(8)5-7(9)4-2;1-3-5-7(9)6(8)4-2/h2*6-9H,3-5H2,1-2H3 |
| InChIKey | ODSARJZARTYGPI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |