C10H22O3 — CID 57273849
decane-3,4,8-triol (PubChem CID 57273849) has the molecular formula C10H22O3 and a molecular weight of 190.28 g/mol. Its IUPAC name is decane-3,4,8-triol.
| Compound Name | decane-3,4,8-triol |
|---|---|
| PubChem CID | 57273849 |
| Molecular Formula | C10H22O3 |
| Molecular Weight | 190.28 g/mol |
| Exact Mass | 190.16 |
| IUPAC Name | decane-3,4,8-triol |
| SMILES | CCC(O)CCCC(O)C(O)CC |
| InChI | InChI=1S/C10H22O3/c1-3-8(11)6-5-7-10(13)9(12)4-2/h8-13H,3-7H2,1-2H3 |
| InChIKey | PPISRRZNKUMMQH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |