C18H38O4 — CID 123917796
octadecane-5,9,10,14-tetrol (PubChem CID 123917796) has the molecular formula C18H38O4 and a molecular weight of 318.50 g/mol. Its IUPAC name is octadecane-5,9,10,14-tetrol.
| Compound Name | octadecane-5,9,10,14-tetrol |
|---|---|
| PubChem CID | 123917796 |
| Molecular Formula | C18H38O4 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.28 |
| IUPAC Name | octadecane-5,9,10,14-tetrol |
| SMILES | CCCCC(O)CCCC(O)C(O)CCCC(O)CCCC |
| InChI | InChI=1S/C18H38O4/c1-3-5-9-15(19)11-7-13-17(21)18(22)14-8-12-16(20)10-6-4-2/h15-22H,3-14H2,1-2H3 |
| InChIKey | GWOCZADCGKDYPZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |