C8H17BF3KO2 — CID 23666197
potassium [(5S,6R)-5,6-dihydroxyoctyl]-trifluoroboranuide (PubChem CID 23666197) has the molecular formula C8H17BF3KO2 and a molecular weight of 252.13 g/mol. Its IUPAC name is potassium [(5S,6R)-5,6-dihydroxyoctyl]-trifluoroboranuide.
| Compound Name | potassium [(5S,6R)-5,6-dihydroxyoctyl]-trifluoroboranuide |
|---|---|
| PubChem CID | 23666197 |
| Molecular Formula | C8H17BF3KO2 |
| Molecular Weight | 252.13 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | potassium [(5S,6R)-5,6-dihydroxyoctyl]-trifluoroboranuide |
| SMILES | CC[C@@H](O)[C@@H](O)CCCC[B-](F)(F)F.[K+] |
| InChI | InChI=1S/C8H17BF3O2.K/c1-2-7(13)8(14)5-3-4-6-9(10,11)12;/h7-8,13-14H,2-6H2,1H3;/q-1;+1/t7-,8+;/m1./s1 |
| InChIKey | ILNNHECYNGMSAF-WLYNEOFISA-N |
| XLogP | -0.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.13 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|