C13H26O3 — CID 163934524
tridec-2-ene-1,10,11-triol (PubChem CID 163934524) has the molecular formula C13H26O3 and a molecular weight of 230.35 g/mol. Its IUPAC name is tridec-2-ene-1,10,11-triol.
| Compound Name | tridec-2-ene-1,10,11-triol |
|---|---|
| PubChem CID | 163934524 |
| Molecular Formula | C13H26O3 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | tridec-2-ene-1,10,11-triol |
| SMILES | CCC(O)C(O)CCCCCCC=CCO |
| InChI | InChI=1S/C13H26O3/c1-2-12(15)13(16)10-8-6-4-3-5-7-9-11-14/h7,9,12-16H,2-6,8,10-11H2,1H3 |
| InChIKey | PIRRLZYBYQVKLG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|